Reaction Summary

Reaction from 5′ triphosphate end (pp(pN)) to 5′ (3′ -dephospho-CoA) (CoA(pN))

Reaction details:

Reaction type level 1: group addition
Reaction type level 2: group addition
Reaction type level 3: group addition
Input group: *P(=O)(O)OP(=O)(O)O
Output group: SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OC[C@H]3O[C@@H](n2cnc1c(N)ncnc12)C(O)[C@H]3O*
Introduced group name: dephospho-coenzyme A
Introduced group type: other group
Site: phosphate
Atom address: O5'.P3
Modification level: 1

Enzymes that catalyse this reaction:

There are no enzymes known for this reaction

 
Image with reaction


Image with reaction

Image with reaction

Entry added on: 2012-09-18 18:18:46.775705, by a user: magda