Reaction Summary

Reaction from queuosine (QtRNA) to Qbase (Qbase)

Reaction details:

Reaction type level 1: N-glycosyl bond hydrolysis
Reaction type level 2: hydrolysis
Reaction type level 3: group removal
Input group: C1=CC(C(C1NCC2=CN(C3=C2C(=O)N=C(N3)N)C4C(C(C(O4)CO)O)O)O)O
Output group: *O
Introduced group name: hydroxyl
Introduced group type: hydroxyl
Site: sugar
Atom address: C1สน
Modification level: 0

Enzymes that catalyse this reaction:

There are no enzymes known for this reaction

 
Image with reaction


Image with reaction

Image with reaction

Entry added on: 2012-08-22 12:51:22.471366, by a user: magda