Modification Summary
queuosine
[show modification pathway]
Summary
| Full name | queuosine |
| Short name | QtRNA |
| New Nomenclature | 10G |
| RNAMods abbreviation | Q |
| HTML abbreviation | Q |
| Enzymes |
QueG (Escherichia coli)
|
| Found in phylogeny | Eubacteria, Eukaryota |
| Found in RNA | tRNA |
| SMILES code | OC4C=CC(NCc2cn(c1N=C(N)NC(=O)c12)[C@@H]3O[C@H](CO)[C@H](O)C3O)C4O |
LC-MS Information
| Sum formula | C17O7N5H23 |
| Monoisotopic mass | 409.1597 |
| Average mass | 409.3998 |
| [M+H]+ | 410.1675 |
| Product ions | 295/163 |
| Normalized LC elution time * | 3,40 (Kellner 2014)
|
| LC elution order/characteristics | after m6A (Kellner 2014) |
* normalized to guanosine (G), measured with a RP C-18 column with acetonitrile/ammonium acetate as mobile phase.
LC-MS Publications
| Title |
Authors |
Journal |
Details |
PubMed Id |
DOI |
| Profiling of RNA modifications by multiplexed stable isotope labelling. |
Kellner S, Neumann J, Rosenkranz D, Lebedeva S, Ketting RF, Zischler H, Schneider D, Helm M. |
Chem Commun (Camb). |
[details]
|
24567952
|
-
|
Chemical groups contained
Reactions producing queuosine
Reactions starting from queuosine
Occurrence in PDB structures
| PDB-ID |
chain |
residue |
| 1c0a |
B |
QUO /634 |
| 1efw |
C |
QUO /34 |
| 1efw |
D |
QUO /34 |
Last modification of this entry: 2017-10-06 16:31:58.707317
Edited by a user: pboccaletto
Edited content: Changed mass_prot.
