Modification Summary
2′-O-ribosyladenosine (phosphate)
[show modification pathway]
Summary
| Full name | 2′-O-ribosyladenosine (phosphate) |
| Short name | Ar(p) |
| New Nomenclature | 00A |
| RNAMods abbreviation | ^ |
| HTML abbreviation | ˆ |
| Enzymes |
Rit1 (Saccharomyces cerevisiae)
|
| Found in phylogeny | Eukaryota |
| Found in RNA | tRNA |
| Sum formula | C15O11N5H22P1 |
| Monoisotopic mass | 479.105343 |
| Average mass | 479.340753 |
| HRMS mass | 479.104794 |
| SMILE code | Nc4ncnc3c4ncn3[C@@H]2O[C@H](CO)C(O)[C@@H]2O[C@@H]1O[C@H](COP(=O)(O)O)[C@H](O)C1O |
Chemical groups contained
| glycosyl group | ribose at O2 |
Reactions producing 2′-O-ribosyladenosine (phosphate)
Occurrence in PDB structures
| PDB-ID |
chain |
residue |
| 1yfg |
|
RIA /64 |
Last modification of this entry: 2013-05-10 16:36:54.059646
Edited by a user: magda
Edited content: Kingdom/s added to a modification
